C15H25NO2 — CID 166438548
(3R,4S)-1,4-dicyclohexyl-3-hydroxyazetidin-2-one (PubChem CID 166438548) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is (3R,4S)-1,4-dicyclohexyl-3-hydroxyazetidin-2-one.
| Compound Name | (3R,4S)-1,4-dicyclohexyl-3-hydroxyazetidin-2-one |
|---|---|
| PubChem CID | 166438548 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | (3R,4S)-1,4-dicyclohexyl-3-hydroxyazetidin-2-one |
| SMILES | O=C1[C@H](O)[C@H](C2CCCCC2)N1C1CCCCC1 |
| InChI | InChI=1S/C15H25NO2/c17-14-13(11-7-3-1-4-8-11)16(15(14)18)12-9-5-2-6-10-12/h11-14,17H,1-10H2/t13-,14+/m0/s1 |
| InChIKey | UVCBLDALFTWICR-UONOGXRCSA-N |
| XLogP | 2.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |