C12H17N3O4 — CID 124631707
(2R,3S)-1-cyclohexyl-4,5-dioxopyrrolidine-2,3-dicarboxamide (PubChem CID 124631707) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is (2R,3S)-1-cyclohexyl-4,5-dioxopyrrolidine-2,3-dicarboxamide.
| Compound Name | (2R,3S)-1-cyclohexyl-4,5-dioxopyrrolidine-2,3-dicarboxamide |
|---|---|
| PubChem CID | 124631707 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | (2R,3S)-1-cyclohexyl-4,5-dioxopyrrolidine-2,3-dicarboxamide |
| SMILES | NC(=O)[C@@H]1C(=O)C(=O)N(C2CCCCC2)[C@H]1C(N)=O |
| InChI | InChI=1S/C12H17N3O4/c13-10(17)7-8(11(14)18)15(12(19)9(7)16)6-4-2-1-3-5-6/h6-8H,1-5H2,(H2,13,17)(H2,14,18)/t7-,8+/m0/s1 |
| InChIKey | XAOGVIHWOSQUGM-JGVFFNPUSA-N |
| XLogP | -1.31 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|