C15H21N3O4 — CID 124631691
(3aR,10aR)-1-cyclohexyl-5,6,7,8,9,10a-hexahydro-3aH-pyrrolo[2,3-g][1,5]diazonine-2,3,4,10-tetrone (PubChem CID 124631691) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is (3aR,10aR)-1-cyclohexyl-5,6,7,8,9,10a-hexahydro-3aH-pyrrolo[2,3-g][1,5]diazonine-2,3,4,10-tetrone.
| Compound Name | (3aR,10aR)-1-cyclohexyl-5,6,7,8,9,10a-hexahydro-3aH-pyrrolo[2,3-g][1,5]diazonine-2,3,4,10-tetrone |
|---|---|
| PubChem CID | 124631691 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | (3aR,10aR)-1-cyclohexyl-5,6,7,8,9,10a-hexahydro-3aH-pyrrolo[2,3-g][1,5]diazonine-2,3,4,10-tetrone |
| SMILES | O=C1NCCCNC(=O)[C@H]2[C@@H]1C(=O)C(=O)N2C1CCCCC1 |
| InChI | InChI=1S/C15H21N3O4/c19-12-10-11(14(21)17-8-4-7-16-13(10)20)18(15(12)22)9-5-2-1-3-6-9/h9-11H,1-8H2,(H,16,20)(H,17,21)/t10-,11-/m1/s1 |
| InChIKey | IZIUEOROSIHOFX-GHMZBOCLSA-N |
| XLogP | -0.65 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|