About 3-chloroazocan-2-one
3-chloroazocan-2-one (PubChem CID 12706376) has the molecular formula C7H12ClNO
and a molecular weight of 161.63 g/mol. Its IUPAC name is 3-chloroazocan-2-one.
Molecular Properties
| Compound Name | 3-chloroazocan-2-one |
| PubChem CID | 12706376 |
| Molecular Formula | C7H12ClNO |
| Molecular Weight | 161.63 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 3-chloroazocan-2-one |
| SMILES | O=C1NCCCCCC1Cl |
| InChI | InChI=1S/C7H12ClNO/c8-6-4-2-1-3-5-9-7(6)10/h6H,1-5H2,(H,9,10) |
| InChIKey | RVTQUNOCGRKGTN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.63 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloroazocan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloroazocan-2-one?
The IUPAC name of 3-chloroazocan-2-one (CID 12706376) is 3-chloroazocan-2-one.
What is the SMILES notation for 3-chloroazocan-2-one?
The canonical SMILES for 3-chloroazocan-2-one is O=C1NCCCCCC1Cl.
What is the InChIKey of 3-chloroazocan-2-one?
The InChIKey is RVTQUNOCGRKGTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClNO/c8-6-4-2-1-3-5-9-7(6)10/h6H,1-5H2,(H,9,10).
What are the key properties of 3-chloroazocan-2-one?
3-chloroazocan-2-one has a molecular weight of 161.63 g/mol, XLogP of 1.28, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloroazocan-2-one is sourced from PubChem (CID 12706376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).