About ethane;3-methylazepan-2-one;propane
ethane;3-methylazepan-2-one;propane (PubChem CID 142177771) has the molecular formula C12H27NO
and a molecular weight of 201.35 g/mol. Its IUPAC name is ethane;3-methylazepan-2-one;propane.
Molecular Properties
| Compound Name | ethane;3-methylazepan-2-one;propane |
| PubChem CID | 142177771 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | ethane;3-methylazepan-2-one;propane |
| SMILES | CC.CC1CCCCNC1=O.CCC |
| InChI | InChI=1S/C7H13NO.C3H8.C2H6/c1-6-4-2-3-5-8-7(6)9;1-3-2;1-2/h6H,2-5H2,1H3,(H,8,9);3H2,1-2H3;1-2H3 |
| InChIKey | BTOISRLCISHWIV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;3-methylazepan-2-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylazepan-2-one;propane?
The IUPAC name of ethane;3-methylazepan-2-one;propane (CID 142177771) is ethane;3-methylazepan-2-one;propane.
What is the SMILES notation for ethane;3-methylazepan-2-one;propane?
The canonical SMILES for ethane;3-methylazepan-2-one;propane is CC.CC1CCCCNC1=O.CCC.
What is the InChIKey of ethane;3-methylazepan-2-one;propane?
The InChIKey is BTOISRLCISHWIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C3H8.C2H6/c1-6-4-2-3-5-8-7(6)9;1-3-2;1-2/h6H,2-5H2,1H3,(H,8,9);3H2,1-2H3;1-2H3.
What are the key properties of ethane;3-methylazepan-2-one;propane?
ethane;3-methylazepan-2-one;propane has a molecular weight of 201.35 g/mol, XLogP of 3.37, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylazepan-2-one;propane is sourced from PubChem (CID 142177771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).