About 3-methylazepan-2-one
3-methylazepan-2-one (PubChem CID 581216) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is 3-methylazepan-2-one.
Molecular Properties
| Compound Name | 3-methylazepan-2-one |
| PubChem CID | 581216 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 3-methylazepan-2-one |
| SMILES | CC1CCCCNC1=O |
| InChI | InChI=1S/C7H13NO/c1-6-4-2-3-5-8-7(6)9/h6H,2-5H2,1H3,(H,8,9) |
| InChIKey | FGSUUFDRDVJCLT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylazepan-2-one?
The IUPAC name of 3-methylazepan-2-one (CID 581216) is 3-methylazepan-2-one.
What is the SMILES notation for 3-methylazepan-2-one?
The canonical SMILES for 3-methylazepan-2-one is CC1CCCCNC1=O.
What is the InChIKey of 3-methylazepan-2-one?
The InChIKey is FGSUUFDRDVJCLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO/c1-6-4-2-3-5-8-7(6)9/h6H,2-5H2,1H3,(H,8,9).
What are the key properties of 3-methylazepan-2-one?
3-methylazepan-2-one has a molecular weight of 127.19 g/mol, XLogP of 0.92, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylazepan-2-one is sourced from PubChem (CID 581216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).