About 3-methylazepan-2-one;molecular hydrogen
3-methylazepan-2-one;molecular hydrogen (PubChem CID 142072840) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is 3-methylazepan-2-one;molecular hydrogen.
Molecular Properties
| Compound Name | 3-methylazepan-2-one;molecular hydrogen |
| PubChem CID | 142072840 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 3-methylazepan-2-one;molecular hydrogen |
| SMILES | CC1CCCCNC1=O.[H][H] |
| InChI | InChI=1S/C7H13NO.H2/c1-6-4-2-3-5-8-7(6)9;/h6H,2-5H2,1H3,(H,8,9);1H |
| InChIKey | DDTBZBAHKUHQCG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylazepan-2-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylazepan-2-one;molecular hydrogen?
The IUPAC name of 3-methylazepan-2-one;molecular hydrogen (CID 142072840) is 3-methylazepan-2-one;molecular hydrogen.
What is the SMILES notation for 3-methylazepan-2-one;molecular hydrogen?
The canonical SMILES for 3-methylazepan-2-one;molecular hydrogen is CC1CCCCNC1=O.[H][H].
What is the InChIKey of 3-methylazepan-2-one;molecular hydrogen?
The InChIKey is DDTBZBAHKUHQCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.H2/c1-6-4-2-3-5-8-7(6)9;/h6H,2-5H2,1H3,(H,8,9);1H.
What are the key properties of 3-methylazepan-2-one;molecular hydrogen?
3-methylazepan-2-one;molecular hydrogen has a molecular weight of 129.20 g/mol, XLogP of 1.17, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylazepan-2-one;molecular hydrogen is sourced from PubChem (CID 142072840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).