About 3-azidoazepan-2-one;molecular hydrogen
3-azidoazepan-2-one;molecular hydrogen (PubChem CID 167688750) has the molecular formula C6H20N4O
and a molecular weight of 164.25 g/mol. Its IUPAC name is 3-azidoazepan-2-one;molecular hydrogen.
Molecular Properties
| Compound Name | 3-azidoazepan-2-one;molecular hydrogen |
| PubChem CID | 167688750 |
| Molecular Formula | C6H20N4O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 3-azidoazepan-2-one;molecular hydrogen |
| SMILES | [H][H].[H][H].[H][H].[H][H].[H][H].[N-]=[N+]=NC1CCCCNC1=O |
| InChI | InChI=1S/C6H10N4O.5H2/c7-10-9-5-3-1-2-4-8-6(5)11;;;;;/h5H,1-4H2,(H,8,11);5*1H |
| InChIKey | WPKQEZNUCVALGE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-azidoazepan-2-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azidoazepan-2-one;molecular hydrogen?
The IUPAC name of 3-azidoazepan-2-one;molecular hydrogen (CID 167688750) is 3-azidoazepan-2-one;molecular hydrogen.
What is the SMILES notation for 3-azidoazepan-2-one;molecular hydrogen?
The canonical SMILES for 3-azidoazepan-2-one;molecular hydrogen is [H][H].[H][H].[H][H].[H][H].[H][H].[N-]=[N+]=NC1CCCCNC1=O.
What is the InChIKey of 3-azidoazepan-2-one;molecular hydrogen?
The InChIKey is WPKQEZNUCVALGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O.5H2/c7-10-9-5-3-1-2-4-8-6(5)11;;;;;/h5H,1-4H2,(H,8,11);5*1H.
What are the key properties of 3-azidoazepan-2-one;molecular hydrogen?
3-azidoazepan-2-one;molecular hydrogen has a molecular weight of 164.25 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azidoazepan-2-one;molecular hydrogen is sourced from PubChem (CID 167688750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).