C11H14N4O — CID 19845922
3-azido-3,4,5,6,6a,7-hexahydro-1H-1-benzazocin-2-one (PubChem CID 19845922) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-azido-3,4,5,6,6a,7-hexahydro-1H-1-benzazocin-2-one.
| Compound Name | 3-azido-3,4,5,6,6a,7-hexahydro-1H-1-benzazocin-2-one |
|---|---|
| PubChem CID | 19845922 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3-azido-3,4,5,6,6a,7-hexahydro-1H-1-benzazocin-2-one |
| SMILES | [N-]=[N+]=NC1CCCC2CC=CC=C2NC1=O |
| InChI | InChI=1S/C11H14N4O/c12-15-14-10-7-3-5-8-4-1-2-6-9(8)13-11(10)16/h1-2,6,8,10H,3-5,7H2,(H,13,16) |
| InChIKey | YVMLXJBRLRTCHV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|