C13H19NO — CID 151869351
2-(oxan-2-yl)-2,3,3a,4-tetrahydro-1H-indole (PubChem CID 151869351) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 2-(oxan-2-yl)-2,3,3a,4-tetrahydro-1H-indole.
| Compound Name | 2-(oxan-2-yl)-2,3,3a,4-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 151869351 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 2-(oxan-2-yl)-2,3,3a,4-tetrahydro-1H-indole |
| SMILES | C1=CCC2CC(C3CCCCO3)NC2=C1 |
| InChI | InChI=1S/C13H19NO/c1-2-6-11-10(5-1)9-12(14-11)13-7-3-4-8-15-13/h1-2,6,10,12-14H,3-5,7-9H2 |
| InChIKey | SMIYDVRYHRACDG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |