C16H14N4O — CID 129405726
(3S)-3-azido-8-phenyl-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 129405726) has the molecular formula C16H14N4O and a molecular weight of 278.31 g/mol. Its IUPAC name is (3S)-3-azido-8-phenyl-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | (3S)-3-azido-8-phenyl-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 129405726 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (3S)-3-azido-8-phenyl-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | [N-]=[N+]=N[C@H]1CCc2ccc(-c3ccccc3)cc2NC1=O |
| InChI | InChI=1S/C16H14N4O/c17-20-19-14-9-8-12-6-7-13(10-15(12)18-16(14)21)11-4-2-1-3-5-11/h1-7,10,14H,8-9H2,(H,18,21)/t14-/m0/s1 |
| InChIKey | APTDBLPBNWDCAV-AWEZNQCLSA-N |
| XLogP | 3.92 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|