C10H9N3O — CID 56947687
1-azido-2,3-dihydro-1H-indene-5-carbaldehyde (PubChem CID 56947687) has the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. Its IUPAC name is 1-azido-2,3-dihydro-1H-indene-5-carbaldehyde.
| Compound Name | 1-azido-2,3-dihydro-1H-indene-5-carbaldehyde |
|---|---|
| PubChem CID | 56947687 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 1-azido-2,3-dihydro-1H-indene-5-carbaldehyde |
| SMILES | [N-]=[N+]=NC1CCc2cc(C=O)ccc21 |
| InChI | InChI=1S/C10H9N3O/c11-13-12-10-4-2-8-5-7(6-14)1-3-9(8)10/h1,3,5-6,10H,2,4H2 |
| InChIKey | AXATYMZLOUGWJW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|