C16H22N4 — CID 86604857
1-[[(5R)-5-azido-5,6,7,8-tetrahydronaphthalen-2-yl]methyl]piperidine (PubChem CID 86604857) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 1-[[(5R)-5-azido-5,6,7,8-tetrahydronaphthalen-2-yl]methyl]piperidine.
| Compound Name | 1-[[(5R)-5-azido-5,6,7,8-tetrahydronaphthalen-2-yl]methyl]piperidine |
|---|---|
| PubChem CID | 86604857 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 1-[[(5R)-5-azido-5,6,7,8-tetrahydronaphthalen-2-yl]methyl]piperidine |
| SMILES | [N-]=[N+]=N[C@@H]1CCCc2cc(CN3CCCCC3)ccc21 |
| InChI | InChI=1S/C16H22N4/c17-19-18-16-6-4-5-14-11-13(7-8-15(14)16)12-20-9-2-1-3-10-20/h7-8,11,16H,1-6,9-10,12H2/t16-/m1/s1 |
| InChIKey | YRVCDSJXSWNYNS-MRXNPFEDSA-N |
| XLogP | 4.36 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|