C17H20N4O2 — CID 143341954
4-amino-N-[(1S)-5-formyl-2,3-dihydro-1H-inden-1-yl]-2,3-bis(methylimino)pent-4-enamide (PubChem CID 143341954) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-amino-N-[(1S)-5-formyl-2,3-dihydro-1H-inden-1-yl]-2,3-bis(methylimino)pent-4-enamide.
| Compound Name | 4-amino-N-[(1S)-5-formyl-2,3-dihydro-1H-inden-1-yl]-2,3-bis(methylimino)pent-4-enamide |
|---|---|
| PubChem CID | 143341954 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 4-amino-N-[(1S)-5-formyl-2,3-dihydro-1H-inden-1-yl]-2,3-bis(methylimino)pent-4-enamide |
| SMILES | C=C(N)C(=N\C)/C(=N\C)C(=O)N[C@H]1CCc2cc(C=O)ccc21 |
| InChI | InChI=1S/C17H20N4O2/c1-10(18)15(19-2)16(20-3)17(23)21-14-7-5-12-8-11(9-22)4-6-13(12)14/h4,6,8-9,14H,1,5,7,18H2,2-3H3,(H,21,23)/b19-15+,20-16+/t14-/m0/s1 |
| InChIKey | APTKLRZKPYOMTF-XYFLCTGDSA-N |
| XLogP | 1.22 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|