C23H26N2O3 — CID 155168323
(E)-3-[1-[[4-(diethylamino)benzoyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoic acid (PubChem CID 155168323) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is (E)-3-[1-[[4-(diethylamino)benzoyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[[4-(diethylamino)benzoyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 155168323 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (E)-3-[1-[[4-(diethylamino)benzoyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoic acid |
| SMILES | CCN(CC)c1ccc(C(=O)NC2CCc3cc(/C=C/C(=O)O)ccc32)cc1 |
| InChI | InChI=1S/C23H26N2O3/c1-3-25(4-2)19-10-7-17(8-11-19)23(28)24-21-13-9-18-15-16(5-12-20(18)21)6-14-22(26)27/h5-8,10-12,14-15,21H,3-4,9,13H2,1-2H3,(H,24,28)(H,26,27)/b14-6+ |
| InChIKey | IHVCSRWRDPWOKB-MKMNVTDBSA-N |
| XLogP | 4.05 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|