C29H37N3O4 — CID 175185005
6-[3-[1-[[4-(diethylamino)benzoyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoylamino]hexanoic acid (PubChem CID 175185005) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is 6-[3-[1-[[4-(diethylamino)benzoyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoylamino]hexanoic acid.
| Compound Name | 6-[3-[1-[[4-(diethylamino)benzoyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoylamino]hexanoic acid |
|---|---|
| PubChem CID | 175185005 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 6-[3-[1-[[4-(diethylamino)benzoyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoylamino]hexanoic acid |
| SMILES | CCN(CC)c1ccc(C(=O)NC2CCc3cc(C=CC(=O)NCCCCCC(=O)O)ccc32)cc1 |
| InChI | InChI=1S/C29H37N3O4/c1-3-32(4-2)24-14-11-22(12-15-24)29(36)31-26-17-13-23-20-21(9-16-25(23)26)10-18-27(33)30-19-7-5-6-8-28(34)35/h9-12,14-16,18,20,26H,3-8,13,17,19H2,1-2H3,(H,30,33)(H,31,36)(H,34,35) |
| InChIKey | LJQLERPTVVHKRB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|