C29H40N3O4+ — CID 155703939
[5-[(E)-3-(5-carboxypentylamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[[4-(diethylamino)cyclohexa-1,5-dien-1-yl]methyl]-oxoazanium (PubChem CID 155703939) has the molecular formula C29H40N3O4+ and a molecular weight of 494.66 g/mol. Its IUPAC name is [5-[(E)-3-(5-carboxypentylamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[[4-(diethylamino)cyclohexa-1,5-dien-1-yl]methyl]-oxoazanium.
| Compound Name | [5-[(E)-3-(5-carboxypentylamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[[4-(diethylamino)cyclohexa-1,5-dien-1-yl]methyl]-oxoazanium |
|---|---|
| PubChem CID | 155703939 |
| Molecular Formula | C29H40N3O4+ |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | [5-[(E)-3-(5-carboxypentylamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[[4-(diethylamino)cyclohexa-1,5-dien-1-yl]methyl]-oxoazanium |
| SMILES | CCN(CC)C1C=CC(C[N+](=O)C2CCc3cc(/C=C/C(=O)NCCCCCC(=O)O)ccc32)=CC1 |
| InChI | InChI=1S/C29H39N3O4/c1-3-31(4-2)25-14-9-23(10-15-25)21-32(36)27-17-13-24-20-22(11-16-26(24)27)12-18-28(33)30-19-7-5-6-8-29(34)35/h9-12,14,16,18,20,25,27H,3-8,13,15,17,19,21H2,1-2H3,(H-,30,33,34,35)/p+1/b18-12+ |
| InChIKey | JAWRSNQHXMTYHK-LDADJPATSA-O |
| XLogP | 4.82 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|