C29H38N4O4 — CID 155168459
4-(diethylamino)-N-[5-[(E)-3-[[6-(hydroxyamino)-6-oxohexyl]amino]-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]benzamide (PubChem CID 155168459) has the molecular formula C29H38N4O4 and a molecular weight of 506.65 g/mol. Its IUPAC name is 4-(diethylamino)-N-[5-[(E)-3-[[6-(hydroxyamino)-6-oxohexyl]amino]-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]benzamide.
| Compound Name | 4-(diethylamino)-N-[5-[(E)-3-[[6-(hydroxyamino)-6-oxohexyl]amino]-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]benzamide |
|---|---|
| PubChem CID | 155168459 |
| Molecular Formula | C29H38N4O4 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 4-(diethylamino)-N-[5-[(E)-3-[[6-(hydroxyamino)-6-oxohexyl]amino]-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]benzamide |
| SMILES | CCN(CC)c1ccc(C(=O)NC2CCc3cc(/C=C/C(=O)NCCCCCC(=O)NO)ccc32)cc1 |
| InChI | InChI=1S/C29H38N4O4/c1-3-33(4-2)24-14-11-22(12-15-24)29(36)31-26-17-13-23-20-21(9-16-25(23)26)10-18-27(34)30-19-7-5-6-8-28(35)32-37/h9-12,14-16,18,20,26,37H,3-8,13,17,19H2,1-2H3,(H,30,34)(H,31,36)(H,32,35)/b18-10+ |
| InChIKey | SUMRYKUBFNXBKY-VCHYOVAHSA-N |
| XLogP | 4.15 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|