C26H28Cl2N2O4 — CID 155168526
8-[[5-[(E)-3-(3,5-dichloroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]amino]-8-oxooctanoic acid (PubChem CID 155168526) has the molecular formula C26H28Cl2N2O4 and a molecular weight of 503.43 g/mol. Its IUPAC name is 8-[[5-[(E)-3-(3,5-dichloroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]amino]-8-oxooctanoic acid.
| Compound Name | 8-[[5-[(E)-3-(3,5-dichloroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]amino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 155168526 |
| Molecular Formula | C26H28Cl2N2O4 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 8-[[5-[(E)-3-(3,5-dichloroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]amino]-8-oxooctanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)NC1CCc2cc(/C=C/C(=O)Nc3cc(Cl)cc(Cl)c3)ccc21 |
| InChI | InChI=1S/C26H28Cl2N2O4/c27-19-14-20(28)16-21(15-19)29-25(32)12-8-17-7-10-22-18(13-17)9-11-23(22)30-24(31)5-3-1-2-4-6-26(33)34/h7-8,10,12-16,23H,1-6,9,11H2,(H,29,32)(H,30,31)(H,33,34)/b12-8+ |
| InChIKey | BEXVIJQNWXYOCY-XYOKQWHBSA-N |
| XLogP | 6.17 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|