C21H19ClN2O2S — CID 58614389
(E)-3-[1-[(5-chloro-1-benzothiophen-3-yl)methylamino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 58614389) has the molecular formula C21H19ClN2O2S and a molecular weight of 398.92 g/mol. Its IUPAC name is (E)-3-[1-[(5-chloro-1-benzothiophen-3-yl)methylamino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[1-[(5-chloro-1-benzothiophen-3-yl)methylamino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 58614389 |
| Molecular Formula | C21H19ClN2O2S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | (E)-3-[1-[(5-chloro-1-benzothiophen-3-yl)methylamino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCC2NCc1csc2ccc(Cl)cc12)NO |
| InChI | InChI=1S/C21H19ClN2O2S/c22-16-4-7-20-18(10-16)15(12-27-20)11-23-19-6-3-14-9-13(1-5-17(14)19)2-8-21(25)24-26/h1-2,4-5,7-10,12,19,23,26H,3,6,11H2,(H,24,25)/b8-2+ |
| InChIKey | LWOLLEKOLUVPEP-KRXBUXKQSA-N |
| XLogP | 4.85 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|