C23H24ClN3O2 — CID 76838127
3-[1-[2-(6-chloro-1H-indol-3-yl)ethyl-methylamino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 76838127) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is 3-[1-[2-(6-chloro-1H-indol-3-yl)ethyl-methylamino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1-[2-(6-chloro-1H-indol-3-yl)ethyl-methylamino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 76838127 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3-[1-[2-(6-chloro-1H-indol-3-yl)ethyl-methylamino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | CN(CCc1c[nH]c2cc(Cl)ccc12)C1CCc2cc(C=CC(=O)NO)ccc21 |
| InChI | InChI=1S/C23H24ClN3O2/c1-27(11-10-17-14-25-21-13-18(24)5-7-19(17)21)22-8-4-16-12-15(2-6-20(16)22)3-9-23(28)26-29/h2-3,5-7,9,12-14,22,25,29H,4,8,10-11H2,1H3,(H,26,28) |
| InChIKey | RLTYQSHBNJYYGX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|