C28H28Cl2N4O3 — CID 76838169
3-[1-[(4,5-dichloro-1H-pyrrol-2-yl)methyl-[2-(6-methoxy-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 76838169) has the molecular formula C28H28Cl2N4O3 and a molecular weight of 539.46 g/mol. Its IUPAC name is 3-[1-[(4,5-dichloro-1H-pyrrol-2-yl)methyl-[2-(6-methoxy-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1-[(4,5-dichloro-1H-pyrrol-2-yl)methyl-[2-(6-methoxy-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 76838169 |
| Molecular Formula | C28H28Cl2N4O3 |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 3-[1-[(4,5-dichloro-1H-pyrrol-2-yl)methyl-[2-(6-methoxy-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | COc1ccc2c(CCN(Cc3cc(Cl)c(Cl)[nH]3)C3CCc4cc(C=CC(=O)NO)ccc43)c[nH]c2c1 |
| InChI | InChI=1S/C28H28Cl2N4O3/c1-37-21-5-7-22-19(15-31-25(22)14-21)10-11-34(16-20-13-24(29)28(30)32-20)26-8-4-18-12-17(2-6-23(18)26)3-9-27(35)33-36/h2-3,5-7,9,12-15,26,31-32,36H,4,8,10-11,16H2,1H3,(H,33,35) |
| InChIKey | KLTLFWCIKYTFSG-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 93.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|