C30H34N4O3 — CID 76838846
3-[1-[(3,5-dimethyl-1H-pyrrol-2-yl)methyl-[2-(6-methoxy-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 76838846) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is 3-[1-[(3,5-dimethyl-1H-pyrrol-2-yl)methyl-[2-(6-methoxy-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1-[(3,5-dimethyl-1H-pyrrol-2-yl)methyl-[2-(6-methoxy-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 76838846 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 3-[1-[(3,5-dimethyl-1H-pyrrol-2-yl)methyl-[2-(6-methoxy-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | COc1ccc2c(CCN(Cc3[nH]c(C)cc3C)C3CCc4cc(C=CC(=O)NO)ccc43)c[nH]c2c1 |
| InChI | InChI=1S/C30H34N4O3/c1-19-14-20(2)32-28(19)18-34(13-12-23-17-31-27-16-24(37-3)7-9-25(23)27)29-10-6-22-15-21(4-8-26(22)29)5-11-30(35)33-36/h4-5,7-9,11,14-17,29,31-32,36H,6,10,12-13,18H2,1-3H3,(H,33,35) |
| InChIKey | WFARVTXUMLQBCJ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 93.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|