C27H25Cl2FN4O2 — CID 58613720
(E)-3-[1-[(3,4-dichloro-1H-pyrrol-2-yl)methyl-[2-(6-fluoro-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 58613720) has the molecular formula C27H25Cl2FN4O2 and a molecular weight of 527.43 g/mol. Its IUPAC name is (E)-3-[1-[(3,4-dichloro-1H-pyrrol-2-yl)methyl-[2-(6-fluoro-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[1-[(3,4-dichloro-1H-pyrrol-2-yl)methyl-[2-(6-fluoro-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 58613720 |
| Molecular Formula | C27H25Cl2FN4O2 |
| Molecular Weight | 527.43 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | (E)-3-[1-[(3,4-dichloro-1H-pyrrol-2-yl)methyl-[2-(6-fluoro-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCC2N(CCc1c[nH]c2cc(F)ccc12)Cc1[nH]cc(Cl)c1Cl)NO |
| InChI | InChI=1S/C27H25Cl2FN4O2/c28-22-14-32-24(27(22)29)15-34(10-9-18-13-31-23-12-19(30)4-6-20(18)23)25-7-3-17-11-16(1-5-21(17)25)2-8-26(35)33-36/h1-2,4-6,8,11-14,25,31-32,36H,3,7,9-10,15H2,(H,33,35)/b8-2+ |
| InChIKey | ZBBBCJJVPQTLAB-KRXBUXKQSA-N |
| XLogP | 6.19 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.43 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|