C27H29ClN5O2+ — CID 58614055
(E)-3-[1-[(4-chloro-2-methyl-1H-pyrazol-2-ium-5-yl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 58614055) has the molecular formula C27H29ClN5O2+ and a molecular weight of 491.02 g/mol. Its IUPAC name is (E)-3-[1-[(4-chloro-2-methyl-1H-pyrazol-2-ium-5-yl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[1-[(4-chloro-2-methyl-1H-pyrazol-2-ium-5-yl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 58614055 |
| Molecular Formula | C27H29ClN5O2+ |
| Molecular Weight | 491.02 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (E)-3-[1-[(4-chloro-2-methyl-1H-pyrazol-2-ium-5-yl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | C[n+]1cc(Cl)c(CN(CCc2c[nH]c3ccccc23)C2CCc3cc(/C=C/C(=O)NO)ccc32)[nH]1 |
| InChI | InChI=1S/C27H28ClN5O2/c1-32-16-23(28)25(30-32)17-33(13-12-20-15-29-24-5-3-2-4-21(20)24)26-10-8-19-14-18(6-9-22(19)26)7-11-27(34)31-35/h2-7,9,11,14-16,26,29H,8,10,12-13,17H2,1H3,(H2,31,34,35)/p+1/b11-7+ |
| InChIKey | GPAUHZQNOJBMES-YRNVUSSQSA-O |
| XLogP | 4.22 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.02 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|