C29H31ClN4O2 — CID 76838728
3-[1-[2-(6-chloro-1H-indol-3-yl)ethyl-[(2,5-dimethyl-1H-pyrrol-3-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 76838728) has the molecular formula C29H31ClN4O2 and a molecular weight of 503.05 g/mol. Its IUPAC name is 3-[1-[2-(6-chloro-1H-indol-3-yl)ethyl-[(2,5-dimethyl-1H-pyrrol-3-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1-[2-(6-chloro-1H-indol-3-yl)ethyl-[(2,5-dimethyl-1H-pyrrol-3-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 76838728 |
| Molecular Formula | C29H31ClN4O2 |
| Molecular Weight | 503.05 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 3-[1-[2-(6-chloro-1H-indol-3-yl)ethyl-[(2,5-dimethyl-1H-pyrrol-3-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | Cc1cc(CN(CCc2c[nH]c3cc(Cl)ccc23)C2CCc3cc(C=CC(=O)NO)ccc32)c(C)[nH]1 |
| InChI | InChI=1S/C29H31ClN4O2/c1-18-13-23(19(2)32-18)17-34(12-11-22-16-31-27-15-24(30)6-8-25(22)27)28-9-5-21-14-20(3-7-26(21)28)4-10-29(35)33-36/h3-4,6-8,10,13-16,28,31-32,36H,5,9,11-12,17H2,1-2H3,(H,33,35) |
| InChIKey | BNLPVLDGEZMYMX-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.05 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|