C30H34N4O2 — CID 76838838
3-[1-[(2,5-dimethyl-1H-pyrrol-3-yl)methyl-[2-(1-methylindol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 76838838) has the molecular formula C30H34N4O2 and a molecular weight of 482.63 g/mol. Its IUPAC name is 3-[1-[(2,5-dimethyl-1H-pyrrol-3-yl)methyl-[2-(1-methylindol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1-[(2,5-dimethyl-1H-pyrrol-3-yl)methyl-[2-(1-methylindol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 76838838 |
| Molecular Formula | C30H34N4O2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 3-[1-[(2,5-dimethyl-1H-pyrrol-3-yl)methyl-[2-(1-methylindol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | Cc1cc(CN(CCc2cn(C)c3ccccc23)C2CCc3cc(C=CC(=O)NO)ccc32)c(C)[nH]1 |
| InChI | InChI=1S/C30H34N4O2/c1-20-16-25(21(2)31-20)19-34(15-14-24-18-33(3)28-7-5-4-6-26(24)28)29-12-10-23-17-22(8-11-27(23)29)9-13-30(35)32-36/h4-9,11,13,16-18,29,31,36H,10,12,14-15,19H2,1-3H3,(H,32,35) |
| InChIKey | JTVSSXPMKACRND-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 73.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|