C28H31N5O2 — CID 76838014
N-hydroxy-3-[1-[2-(1-methylindol-3-yl)ethyl-[(1-methylpyrazol-4-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide (PubChem CID 76838014) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-hydroxy-3-[1-[2-(1-methylindol-3-yl)ethyl-[(1-methylpyrazol-4-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide.
| Compound Name | N-hydroxy-3-[1-[2-(1-methylindol-3-yl)ethyl-[(1-methylpyrazol-4-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 76838014 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | N-hydroxy-3-[1-[2-(1-methylindol-3-yl)ethyl-[(1-methylpyrazol-4-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
| SMILES | Cn1cc(CN(CCc2cn(C)c3ccccc23)C2CCc3cc(C=CC(=O)NO)ccc32)cn1 |
| InChI | InChI=1S/C28H31N5O2/c1-31-19-23(24-5-3-4-6-26(24)31)13-14-33(18-21-16-29-32(2)17-21)27-11-9-22-15-20(7-10-25(22)27)8-12-28(34)30-35/h3-8,10,12,15-17,19,27,35H,9,11,13-14,18H2,1-2H3,(H,30,34) |
| InChIKey | ROXUXKHGYNYTEF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 75.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|