C32H44N2O3Si — CID 58613870
methyl (E)-3-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[2-(1-methylindol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate (PubChem CID 58613870) has the molecular formula C32H44N2O3Si and a molecular weight of 532.80 g/mol. Its IUPAC name is methyl (E)-3-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[2-(1-methylindol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[2-(1-methylindol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 58613870 |
| Molecular Formula | C32H44N2O3Si |
| Molecular Weight | 532.80 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | methyl (E)-3-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[2-(1-methylindol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1)CCC2N(CCO[Si](C)(C)C(C)(C)C)CCc1cn(C)c2ccccc12 |
| InChI | InChI=1S/C32H44N2O3Si/c1-32(2,3)38(6,7)37-21-20-34(19-18-26-23-33(4)29-11-9-8-10-27(26)29)30-16-14-25-22-24(12-15-28(25)30)13-17-31(35)36-5/h8-13,15,17,22-23,30H,14,16,18-21H2,1-7H3/b17-13+ |
| InChIKey | HGFRMKHOHZBONH-GHRIWEEISA-N |
| XLogP | 6.92 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.80 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|