C28H28Cl2N4O2 — CID 76838537
3-[1-[(4,5-dichloro-1H-pyrrol-2-yl)methyl-[2-(1-methylindol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 76838537) has the molecular formula C28H28Cl2N4O2 and a molecular weight of 523.46 g/mol. Its IUPAC name is 3-[1-[(4,5-dichloro-1H-pyrrol-2-yl)methyl-[2-(1-methylindol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1-[(4,5-dichloro-1H-pyrrol-2-yl)methyl-[2-(1-methylindol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 76838537 |
| Molecular Formula | C28H28Cl2N4O2 |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 3-[1-[(4,5-dichloro-1H-pyrrol-2-yl)methyl-[2-(1-methylindol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | Cn1cc(CCN(Cc2cc(Cl)c(Cl)[nH]2)C2CCc3cc(C=CC(=O)NO)ccc32)c2ccccc21 |
| InChI | InChI=1S/C28H28Cl2N4O2/c1-33-16-20(22-4-2-3-5-25(22)33)12-13-34(17-21-15-24(29)28(30)31-21)26-10-8-19-14-18(6-9-23(19)26)7-11-27(35)32-36/h2-7,9,11,14-16,26,31,36H,8,10,12-13,17H2,1H3,(H,32,35) |
| InChIKey | FUXQALPCPNBRKE-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 73.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|