C28H27ClF3N5O2 — CID 58614042
(E)-3-[1-[[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 58614042) has the molecular formula C28H27ClF3N5O2 and a molecular weight of 558.00 g/mol. Its IUPAC name is (E)-3-[1-[[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[1-[[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 58614042 |
| Molecular Formula | C28H27ClF3N5O2 |
| Molecular Weight | 558.00 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | (E)-3-[1-[[5-chloro-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | Cn1nc(C(F)(F)F)c(CN(CCc2c[nH]c3ccccc23)C2CCc3cc(/C=C/C(=O)NO)ccc32)c1Cl |
| InChI | InChI=1S/C28H27ClF3N5O2/c1-36-27(29)22(26(34-36)28(30,31)32)16-37(13-12-19-15-33-23-5-3-2-4-20(19)23)24-10-8-18-14-17(6-9-21(18)24)7-11-25(38)35-39/h2-7,9,11,14-15,24,33,39H,8,10,12-13,16H2,1H3,(H,35,38)/b11-7+ |
| InChIKey | ATTKFMGTMDOPJR-YRNVUSSQSA-N |
| XLogP | 5.82 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.00 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|