C32H43FN2O3Si — CID 76838925
methyl 3-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate (PubChem CID 76838925) has the molecular formula C32H43FN2O3Si and a molecular weight of 550.79 g/mol. Its IUPAC name is methyl 3-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate.
| Compound Name | methyl 3-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 76838925 |
| Molecular Formula | C32H43FN2O3Si |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | methyl 3-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc2c(c1)CCC2N(CCO[Si](C)(C)C(C)(C)C)CCc1c(C)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C32H43FN2O3Si/c1-22-26(28-21-25(33)11-13-29(28)34-22)16-17-35(18-19-38-39(6,7)32(2,3)4)30-14-10-24-20-23(8-12-27(24)30)9-15-31(36)37-5/h8-9,11-13,15,20-21,30,34H,10,14,16-19H2,1-7H3 |
| InChIKey | IXDWOIDTHYXSBR-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|