C23H26FNO4 — CID 76838029
methyl 3-[1-[2-(3-fluorophenoxy)ethyl-(2-hydroxyethyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate (PubChem CID 76838029) has the molecular formula C23H26FNO4 and a molecular weight of 399.46 g/mol. Its IUPAC name is methyl 3-[1-[2-(3-fluorophenoxy)ethyl-(2-hydroxyethyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate.
| Compound Name | methyl 3-[1-[2-(3-fluorophenoxy)ethyl-(2-hydroxyethyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 76838029 |
| Molecular Formula | C23H26FNO4 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | methyl 3-[1-[2-(3-fluorophenoxy)ethyl-(2-hydroxyethyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc2c(c1)CCC2N(CCO)CCOc1cccc(F)c1 |
| InChI | InChI=1S/C23H26FNO4/c1-28-23(27)10-6-17-5-8-21-18(15-17)7-9-22(21)25(11-13-26)12-14-29-20-4-2-3-19(24)16-20/h2-6,8,10,15-16,22,26H,7,9,11-14H2,1H3 |
| InChIKey | GHHJWJCMWWPXAK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|