C30H33FN4O2 — CID 76838882
3-[1-[2-(6-fluoro-1H-indol-3-yl)ethyl-[(3,4,5-trimethyl-1H-pyrrol-2-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 76838882) has the molecular formula C30H33FN4O2 and a molecular weight of 500.62 g/mol. Its IUPAC name is 3-[1-[2-(6-fluoro-1H-indol-3-yl)ethyl-[(3,4,5-trimethyl-1H-pyrrol-2-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1-[2-(6-fluoro-1H-indol-3-yl)ethyl-[(3,4,5-trimethyl-1H-pyrrol-2-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 76838882 |
| Molecular Formula | C30H33FN4O2 |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | 3-[1-[2-(6-fluoro-1H-indol-3-yl)ethyl-[(3,4,5-trimethyl-1H-pyrrol-2-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | Cc1[nH]c(CN(CCc2c[nH]c3cc(F)ccc23)C2CCc3cc(C=CC(=O)NO)ccc32)c(C)c1C |
| InChI | InChI=1S/C30H33FN4O2/c1-18-19(2)28(33-20(18)3)17-35(13-12-23-16-32-27-15-24(31)7-9-25(23)27)29-10-6-22-14-21(4-8-26(22)29)5-11-30(36)34-37/h4-5,7-9,11,14-16,29,32-33,37H,6,10,12-13,17H2,1-3H3,(H,34,36) |
| InChIKey | CHNHSKQYVLTHMK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|