C28H32Cl2N2O4 — CID 155181468
ethyl 8-[[5-[(E)-3-(3,5-dichloroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]amino]-8-oxooctanoate (PubChem CID 155181468) has the molecular formula C28H32Cl2N2O4 and a molecular weight of 531.48 g/mol. Its IUPAC name is ethyl 8-[[5-[(E)-3-(3,5-dichloroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]amino]-8-oxooctanoate.
| Compound Name | ethyl 8-[[5-[(E)-3-(3,5-dichloroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]amino]-8-oxooctanoate |
|---|---|
| PubChem CID | 155181468 |
| Molecular Formula | C28H32Cl2N2O4 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | ethyl 8-[[5-[(E)-3-(3,5-dichloroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]amino]-8-oxooctanoate |
| SMILES | CCOC(=O)CCCCCCC(=O)NC1CCc2cc(/C=C/C(=O)Nc3cc(Cl)cc(Cl)c3)ccc21 |
| InChI | InChI=1S/C28H32Cl2N2O4/c1-2-36-28(35)8-6-4-3-5-7-26(33)32-25-13-11-20-15-19(9-12-24(20)25)10-14-27(34)31-23-17-21(29)16-22(30)18-23/h9-10,12,14-18,25H,2-8,11,13H2,1H3,(H,31,34)(H,32,33)/b14-10+ |
| InChIKey | IWXVDKKQKXVUOC-GXDHUFHOSA-N |
| XLogP | 6.65 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|