C32H33Cl2FN4O3 — CID 155181392
N'-(2-amino-4-fluorophenyl)-N-[5-[(E)-3-(3,5-dichloroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]octanediamide (PubChem CID 155181392) has the molecular formula C32H33Cl2FN4O3 and a molecular weight of 611.55 g/mol. Its IUPAC name is N'-(2-amino-4-fluorophenyl)-N-[5-[(E)-3-(3,5-dichloroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]octanediamide.
| Compound Name | N'-(2-amino-4-fluorophenyl)-N-[5-[(E)-3-(3,5-dichloroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]octanediamide |
|---|---|
| PubChem CID | 155181392 |
| Molecular Formula | C32H33Cl2FN4O3 |
| Molecular Weight | 611.55 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | N'-(2-amino-4-fluorophenyl)-N-[5-[(E)-3-(3,5-dichloroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]octanediamide |
| SMILES | Nc1cc(F)ccc1NC(=O)CCCCCCC(=O)NC1CCc2cc(/C=C/C(=O)Nc3cc(Cl)cc(Cl)c3)ccc21 |
| InChI | InChI=1S/C32H33Cl2FN4O3/c33-22-16-23(34)18-25(17-22)37-32(42)14-8-20-7-11-26-21(15-20)9-12-28(26)38-30(40)5-3-1-2-4-6-31(41)39-29-13-10-24(35)19-27(29)36/h7-8,10-11,13-19,28H,1-6,9,12,36H2,(H,37,42)(H,38,40)(H,39,41)/b14-8+ |
| InChIKey | QRBWRDQKILCMAD-RIYZIHGNSA-N |
| XLogP | 7.45 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.55 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|