C34H38FN4O3+ — CID 155703674
[8-(2-amino-4-fluoroanilino)-8-oxooctyl]-[5-[(E)-3-(3,5-dimethylanilino)-3-oxoprop-1-enyl]-1H-inden-1-yl]-oxoazanium (PubChem CID 155703674) has the molecular formula C34H38FN4O3+ and a molecular weight of 569.70 g/mol. Its IUPAC name is [8-(2-amino-4-fluoroanilino)-8-oxooctyl]-[5-[(E)-3-(3,5-dimethylanilino)-3-oxoprop-1-enyl]-1H-inden-1-yl]-oxoazanium.
| Compound Name | [8-(2-amino-4-fluoroanilino)-8-oxooctyl]-[5-[(E)-3-(3,5-dimethylanilino)-3-oxoprop-1-enyl]-1H-inden-1-yl]-oxoazanium |
|---|---|
| PubChem CID | 155703674 |
| Molecular Formula | C34H38FN4O3+ |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | [8-(2-amino-4-fluoroanilino)-8-oxooctyl]-[5-[(E)-3-(3,5-dimethylanilino)-3-oxoprop-1-enyl]-1H-inden-1-yl]-oxoazanium |
| SMILES | Cc1cc(C)cc(NC(=O)/C=C/c2ccc3c(c2)C=CC3[N+](=O)CCCCCCCC(=O)Nc2ccc(F)cc2N)c1 |
| InChI | InChI=1S/C34H37FN4O3/c1-23-18-24(2)20-28(19-23)37-34(41)16-10-25-9-13-29-26(21-25)11-15-32(29)39(42)17-7-5-3-4-6-8-33(40)38-31-14-12-27(35)22-30(31)36/h9-16,18-22,32H,3-8,17,36H2,1-2H3,(H-,37,38,40,41)/p+1/b16-10+ |
| InChIKey | ZQVZJJMDDDMBKO-MHWRWJLKSA-O |
| XLogP | 7.50 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|