C20H20FNO2 — CID 155181143
(E)-3-[1-[2-(4-fluorophenyl)ethylamino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoic acid (PubChem CID 155181143) has the molecular formula C20H20FNO2 and a molecular weight of 325.38 g/mol. Its IUPAC name is (E)-3-[1-[2-(4-fluorophenyl)ethylamino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[2-(4-fluorophenyl)ethylamino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 155181143 |
| Molecular Formula | C20H20FNO2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (E)-3-[1-[2-(4-fluorophenyl)ethylamino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc2c(c1)CCC2NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FNO2/c21-17-6-1-14(2-7-17)11-12-22-19-9-5-16-13-15(3-8-18(16)19)4-10-20(23)24/h1-4,6-8,10,13,19,22H,5,9,11-12H2,(H,23,24)/b10-4+ |
| InChIKey | GGXOOESZKMIKRT-ONNFQVAWSA-N |
| XLogP | 3.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|