C19H21Cl2NO2Y — CID 155703898
(E)-2-[1-[2-(3,5-dichlorophenyl)ethylamino]-2,3-dihydro-1H-inden-5-yl]ethenol;yttrium;hydrate (PubChem CID 155703898) has the molecular formula C19H21Cl2NO2Y and a molecular weight of 455.19 g/mol. Its IUPAC name is (E)-2-[1-[2-(3,5-dichlorophenyl)ethylamino]-2,3-dihydro-1H-inden-5-yl]ethenol;yttrium;hydrate.
| Compound Name | (E)-2-[1-[2-(3,5-dichlorophenyl)ethylamino]-2,3-dihydro-1H-inden-5-yl]ethenol;yttrium;hydrate |
|---|---|
| PubChem CID | 155703898 |
| Molecular Formula | C19H21Cl2NO2Y |
| Molecular Weight | 455.19 g/mol |
| Exact Mass | 454.00 |
| IUPAC Name | (E)-2-[1-[2-(3,5-dichlorophenyl)ethylamino]-2,3-dihydro-1H-inden-5-yl]ethenol;yttrium;hydrate |
| SMILES | O.O/C=C/c1ccc2c(c1)CCC2NCCc1cc(Cl)cc(Cl)c1.[Y] |
| InChI | InChI=1S/C19H19Cl2NO.H2O.Y/c20-16-10-14(11-17(21)12-16)5-7-22-19-4-2-15-9-13(6-8-23)1-3-18(15)19;;/h1,3,6,8-12,19,22-23H,2,4-5,7H2;1H2;/b8-6+;; |
| InChIKey | AJKNIIDMXGXSJE-OVGXCEQFSA-N |
| XLogP | 4.51 |
| TPSA | 63.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.19 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|