C21H27NO3Y — CID 155703967
methanol;(E)-2-[1-[2-(4-methoxyphenyl)ethylamino]-2,3-dihydro-1H-inden-5-yl]ethenol;yttrium (PubChem CID 155703967) has the molecular formula C21H27NO3Y and a molecular weight of 430.36 g/mol. Its IUPAC name is methanol;(E)-2-[1-[2-(4-methoxyphenyl)ethylamino]-2,3-dihydro-1H-inden-5-yl]ethenol;yttrium.
| Compound Name | methanol;(E)-2-[1-[2-(4-methoxyphenyl)ethylamino]-2,3-dihydro-1H-inden-5-yl]ethenol;yttrium |
|---|---|
| PubChem CID | 155703967 |
| Molecular Formula | C21H27NO3Y |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | methanol;(E)-2-[1-[2-(4-methoxyphenyl)ethylamino]-2,3-dihydro-1H-inden-5-yl]ethenol;yttrium |
| SMILES | CO.COc1ccc(CCNC2CCc3cc(/C=C/O)ccc32)cc1.[Y] |
| InChI | InChI=1S/C20H23NO2.CH4O.Y/c1-23-18-6-2-15(3-7-18)10-12-21-20-9-5-17-14-16(11-13-22)4-8-19(17)20;1-2;/h2-4,6-8,11,13-14,20-22H,5,9-10,12H2,1H3;2H,1H3;/b13-11+;; |
| InChIKey | SJQQLHIYNRWPDC-UAIOKUCGSA-N |
| XLogP | 3.65 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|