C20H24N2O3 — CID 58614548
methyl (E)-3-[1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate (PubChem CID 58614548) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is methyl (E)-3-[1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 58614548 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | methyl (E)-3-[1-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1)CCC2NCCc1c(C)noc1C |
| InChI | InChI=1S/C20H24N2O3/c1-13-17(14(2)25-22-13)10-11-21-19-8-6-16-12-15(4-7-18(16)19)5-9-20(23)24-3/h4-5,7,9,12,19,21H,6,8,10-11H2,1-3H3/b9-5+ |
| InChIKey | UAKZRRIDFXJZBO-WEVVVXLNSA-N |
| XLogP | 3.30 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|