C28H28FN3O4 — CID 155168679
[5-[(E)-3-(2-amino-4-fluoroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(4-methoxyphenyl)ethyl]carbamic acid (PubChem CID 155168679) has the molecular formula C28H28FN3O4 and a molecular weight of 489.55 g/mol. Its IUPAC name is [5-[(E)-3-(2-amino-4-fluoroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(4-methoxyphenyl)ethyl]carbamic acid.
| Compound Name | [5-[(E)-3-(2-amino-4-fluoroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(4-methoxyphenyl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 155168679 |
| Molecular Formula | C28H28FN3O4 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | [5-[(E)-3-(2-amino-4-fluoroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[2-(4-methoxyphenyl)ethyl]carbamic acid |
| SMILES | COc1ccc(CCN(C(=O)O)C2CCc3cc(/C=C/C(=O)Nc4ccc(F)cc4N)ccc32)cc1 |
| InChI | InChI=1S/C28H28FN3O4/c1-36-22-8-2-18(3-9-22)14-15-32(28(34)35)26-12-6-20-16-19(4-10-23(20)26)5-13-27(33)31-25-11-7-21(29)17-24(25)30/h2-5,7-11,13,16-17,26H,6,12,14-15,30H2,1H3,(H,31,33)(H,34,35)/b13-5+ |
| InChIKey | WYACPCGYESEGCA-WLRTZDKTSA-N |
| XLogP | 5.28 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|