C27H32FN3O — CID 118699562
(E)-N-(2-amino-4-fluorophenyl)-3-[4-[[methyl(3-tricyclo[3.3.1.03,7]nonanylmethyl)amino]methyl]phenyl]prop-2-enamide (PubChem CID 118699562) has the molecular formula C27H32FN3O and a molecular weight of 433.57 g/mol. Its IUPAC name is (E)-N-(2-amino-4-fluorophenyl)-3-[4-[[methyl(3-tricyclo[3.3.1.03,7]nonanylmethyl)amino]methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-amino-4-fluorophenyl)-3-[4-[[methyl(3-tricyclo[3.3.1.03,7]nonanylmethyl)amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118699562 |
| Molecular Formula | C27H32FN3O |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | (E)-N-(2-amino-4-fluorophenyl)-3-[4-[[methyl(3-tricyclo[3.3.1.03,7]nonanylmethyl)amino]methyl]phenyl]prop-2-enamide |
| SMILES | CN(Cc1ccc(/C=C/C(=O)Nc2ccc(F)cc2N)cc1)CC12CC3CC(CC1C3)C2 |
| InChI | InChI=1S/C27H32FN3O/c1-31(17-27-14-20-10-21(15-27)12-22(27)11-20)16-19-4-2-18(3-5-19)6-9-26(32)30-25-8-7-23(28)13-24(25)29/h2-9,13,20-22H,10-12,14-17,29H2,1H3,(H,30,32)/b9-6+ |
| InChIKey | AUKKTKHBBHSQDS-RMKNXTFCSA-N |
| XLogP | 5.32 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|