C27H33N3O — CID 118699503
(E)-3-[4-[(1-adamantylmethylamino)methyl]phenyl]-N-(2-aminophenyl)prop-2-enamide (PubChem CID 118699503) has the molecular formula C27H33N3O and a molecular weight of 415.58 g/mol. Its IUPAC name is (E)-3-[4-[(1-adamantylmethylamino)methyl]phenyl]-N-(2-aminophenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-[(1-adamantylmethylamino)methyl]phenyl]-N-(2-aminophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 118699503 |
| Molecular Formula | C27H33N3O |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | (E)-3-[4-[(1-adamantylmethylamino)methyl]phenyl]-N-(2-aminophenyl)prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1ccc(CNCC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C27H33N3O/c28-24-3-1-2-4-25(24)30-26(31)10-9-19-5-7-20(8-6-19)17-29-18-27-14-21-11-22(15-27)13-23(12-21)16-27/h1-10,21-23,29H,11-18,28H2,(H,30,31)/b10-9+ |
| InChIKey | RYHHEISRDHEESD-MDZDMXLPSA-N |
| XLogP | 5.23 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|