C24H31N3O — CID 118699488
(E)-N-(2-aminophenyl)-3-[4-[[cyclohexylmethyl(methyl)amino]methyl]phenyl]prop-2-enamide (PubChem CID 118699488) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[4-[[cyclohexylmethyl(methyl)amino]methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[4-[[cyclohexylmethyl(methyl)amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118699488 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[4-[[cyclohexylmethyl(methyl)amino]methyl]phenyl]prop-2-enamide |
| SMILES | CN(Cc1ccc(/C=C/C(=O)Nc2ccccc2N)cc1)CC1CCCCC1 |
| InChI | InChI=1S/C24H31N3O/c1-27(17-20-7-3-2-4-8-20)18-21-13-11-19(12-14-21)15-16-24(28)26-23-10-6-5-9-22(23)25/h5-6,9-16,20H,2-4,7-8,17-18,25H2,1H3,(H,26,28)/b16-15+ |
| InChIKey | OHSOYUJJGXICCS-FOCLMDBBSA-N |
| XLogP | 4.93 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|