C26H31N3O — CID 46199541
(E)-3-[4-[(1-adamantylamino)methyl]phenyl]-N-(2-aminophenyl)prop-2-enamide (PubChem CID 46199541) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is (E)-3-[4-[(1-adamantylamino)methyl]phenyl]-N-(2-aminophenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-[(1-adamantylamino)methyl]phenyl]-N-(2-aminophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 46199541 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | (E)-3-[4-[(1-adamantylamino)methyl]phenyl]-N-(2-aminophenyl)prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1ccc(CNC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C26H31N3O/c27-23-3-1-2-4-24(23)29-25(30)10-9-18-5-7-19(8-6-18)17-28-26-14-20-11-21(15-26)13-22(12-20)16-26/h1-10,20-22,28H,11-17,27H2,(H,29,30)/b10-9+ |
| InChIKey | IFALMIROFQNMGM-MDZDMXLPSA-N |
| XLogP | 4.98 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|