C20H25ClN2O2 — CID 71600457
(E)-3-[4-[[[(5S,7R)-3-chloro-1-adamantyl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 71600457) has the molecular formula C20H25ClN2O2 and a molecular weight of 360.88 g/mol. Its IUPAC name is (E)-3-[4-[[[(5S,7R)-3-chloro-1-adamantyl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[[(5S,7R)-3-chloro-1-adamantyl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 71600457 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.88 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (E)-3-[4-[[[(5S,7R)-3-chloro-1-adamantyl]amino]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(CNC23C[C@@H]4C[C@@H](CC(Cl)(C4)C2)C3)cc1)NO |
| InChI | InChI=1S/C20H25ClN2O2/c21-19-8-16-7-17(9-19)11-20(10-16,13-19)22-12-15-3-1-14(2-4-15)5-6-18(24)23-25/h1-6,16-17,22,25H,7-13H2,(H,23,24)/b6-5+/t16-,17+,19?,20? |
| InChIKey | LJHIJFDWCLDXSN-NVBHUSKCSA-N |
| XLogP | 3.62 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.88 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|