C20H28N3O2+ — CID 145010715
(E)-3-[4-[(1-azoniatricyclo[3.3.1.13,7]decan-1-ylmethylamino)methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 145010715) has the molecular formula C20H28N3O2+ and a molecular weight of 342.46 g/mol. Its IUPAC name is (E)-3-[4-[(1-azoniatricyclo[3.3.1.13,7]decan-1-ylmethylamino)methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[(1-azoniatricyclo[3.3.1.13,7]decan-1-ylmethylamino)methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 145010715 |
| Molecular Formula | C20H28N3O2+ |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (E)-3-[4-[(1-azoniatricyclo[3.3.1.13,7]decan-1-ylmethylamino)methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(CNC[N+]23CC4CC(CC(C4)C2)C3)cc1)NO |
| InChI | InChI=1S/C20H27N3O2/c24-20(22-25)6-5-15-1-3-16(4-2-15)10-21-14-23-11-17-7-18(12-23)9-19(8-17)13-23/h1-6,17-19,21H,7-14H2,(H-,22,24,25)/p+1/b6-5+ |
| InChIKey | HSSRAEABPJPERR-AATRIKPKSA-O |
| XLogP | 2.13 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|