C22H22N4O3S — CID 20786001
(E)-N-(2-aminophenyl)-3-[4-[(3-sulfamoylanilino)methyl]phenyl]prop-2-enamide (PubChem CID 20786001) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[4-[(3-sulfamoylanilino)methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[4-[(3-sulfamoylanilino)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 20786001 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[4-[(3-sulfamoylanilino)methyl]phenyl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1ccc(CNc2cccc(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C22H22N4O3S/c23-20-6-1-2-7-21(20)26-22(27)13-12-16-8-10-17(11-9-16)15-25-18-4-3-5-19(14-18)30(24,28)29/h1-14,25H,15,23H2,(H,26,27)(H2,24,28,29)/b13-12+ |
| InChIKey | HELWDRRDHUZGQE-OUKQBFOZSA-N |
| XLogP | 3.18 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|