C24H34N2O — CID 122548335
(E)-N-methyl-3-[4-[[(111C)methyl(1-tricyclo[4.3.1.13,8]undecanylmethyl)amino]methyl]phenyl]prop-2-enamide (PubChem CID 122548335) has the molecular formula C24H34N2O and a molecular weight of 365.55 g/mol. Its IUPAC name is (E)-N-methyl-3-[4-[[(111C)methyl(1-tricyclo[4.3.1.13,8]undecanylmethyl)amino]methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-methyl-3-[4-[[(111C)methyl(1-tricyclo[4.3.1.13,8]undecanylmethyl)amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122548335 |
| Molecular Formula | C24H34N2O |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | (E)-N-methyl-3-[4-[[(111C)methyl(1-tricyclo[4.3.1.13,8]undecanylmethyl)amino]methyl]phenyl]prop-2-enamide |
| SMILES | CNC(=O)/C=C/c1ccc(CN([11CH3])CC23CC4CCC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C24H34N2O/c1-25-23(27)10-9-18-3-5-19(6-4-18)16-26(2)17-24-13-20-7-8-21(14-24)12-22(11-20)15-24/h3-6,9-10,20-22H,7-8,11-17H2,1-2H3,(H,25,27)/b10-9+/i2-1 |
| InChIKey | FKJSXZITRWZRBZ-QEMOTPMJSA-N |
| XLogP | 4.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|